C11H13FINO2 — CID 171249950
ethyl (3S)-3-amino-2-fluoro-3-(3-iodophenyl)propanoate (PubChem CID 171249950) has the molecular formula C11H13FINO2 and a molecular weight of 337.13 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(3-iodophenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(3-iodophenyl)propanoate |
|---|---|
| PubChem CID | 171249950 |
| Molecular Formula | C11H13FINO2 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(3-iodophenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cccc(I)c1 |
| InChI | InChI=1S/C11H13FINO2/c1-2-16-11(15)9(12)10(14)7-4-3-5-8(13)6-7/h3-6,9-10H,2,14H2,1H3/t9?,10-/m0/s1 |
| InChIKey | BTDJVNGVXONBOR-AXDSSHIGSA-N |
| XLogP | 2.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|