C15H17ClFNO3 — CID 171240201
ethyl (3R)-3-amino-2-fluoro-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride (PubChem CID 171240201) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171240201 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc2cc(O)ccc2c1.Cl |
| InChI | InChI=1S/C15H16FNO3.ClH/c1-2-20-15(19)13(16)14(17)11-4-3-10-8-12(18)6-5-9(10)7-11;/h3-8,13-14,18H,2,17H2,1H3;1H/t13?,14-;/m1./s1 |
| InChIKey | KUOQKLSSOUKFKQ-BAGZVPGASA-N |
| XLogP | 2.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |