C12H17ClFNO2S — CID 171250617
ethyl (3S)-3-amino-2-fluoro-3-(4-methylsulfanylphenyl)propanoate;hydrochloride (PubChem CID 171250617) has the molecular formula C12H17ClFNO2S and a molecular weight of 293.79 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(4-methylsulfanylphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171250617 |
| Molecular Formula | C12H17ClFNO2S |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(SC)cc1.Cl |
| InChI | InChI=1S/C12H16FNO2S.ClH/c1-3-16-12(15)10(13)11(14)8-4-6-9(17-2)7-5-8;/h4-7,10-11H,3,14H2,1-2H3;1H/t10?,11-;/m0./s1 |
| InChIKey | JRCOBJFZICDARN-GQNCZFCYSA-N |
| XLogP | 2.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |