C18H21ClFNO3 — CID 171250179
ethyl (3S)-3-amino-2-fluoro-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride (PubChem CID 171250179) has the molecular formula C18H21ClFNO3 and a molecular weight of 353.82 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171250179 |
| Molecular Formula | C18H21ClFNO3 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(4-phenylmethoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H20FNO3.ClH/c1-2-22-18(21)16(19)17(20)14-8-10-15(11-9-14)23-12-13-6-4-3-5-7-13;/h3-11,16-17H,2,12,20H2,1H3;1H/t16?,17-;/m0./s1 |
| InChIKey | UXIJVRVVFWFVRI-KRNWZFANSA-N |
| XLogP | 3.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |