C20H22O5 — CID 69110170
ethyl 4-hydroxy-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate (PubChem CID 69110170) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is ethyl 4-hydroxy-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate.
| Compound Name | ethyl 4-hydroxy-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 69110170 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | ethyl 4-hydroxy-3-methyl-2-oxo-4-(4-phenylmethoxyphenyl)butanoate |
| SMILES | CCOC(=O)C(=O)C(C)C(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O5/c1-3-24-20(23)19(22)14(2)18(21)16-9-11-17(12-10-16)25-13-15-7-5-4-6-8-15/h4-12,14,18,21H,3,13H2,1-2H3 |
| InChIKey | XMMFVFWCOZBTEI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|