C15H17NO3 — CID 70474392
1-amino-2-(4-phenylmethoxyphenyl)ethane-1,2-diol (PubChem CID 70474392) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-amino-2-(4-phenylmethoxyphenyl)ethane-1,2-diol.
| Compound Name | 1-amino-2-(4-phenylmethoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 70474392 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-amino-2-(4-phenylmethoxyphenyl)ethane-1,2-diol |
| SMILES | NC(O)C(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17NO3/c16-15(18)14(17)12-6-8-13(9-7-12)19-10-11-4-2-1-3-5-11/h1-9,14-15,17-18H,10,16H2 |
| InChIKey | DGFAJSJBTZTBKJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|