C17H19BrO3 — CID 171893021
4-bromo-1-(4-phenylmethoxyphenyl)butane-1,2-diol (PubChem CID 171893021) has the molecular formula C17H19BrO3 and a molecular weight of 351.24 g/mol. Its IUPAC name is 4-bromo-1-(4-phenylmethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(4-phenylmethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893021 |
| Molecular Formula | C17H19BrO3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-bromo-1-(4-phenylmethoxyphenyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19BrO3/c18-11-10-16(19)17(20)14-6-8-15(9-7-14)21-12-13-4-2-1-3-5-13/h1-9,16-17,19-20H,10-12H2 |
| InChIKey | ASKYPCDGPPMOGY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|