C24H27NO2 — CID 69303183
(1S,2R)-2-(2-phenylethylamino)-1-(4-phenylmethoxyphenyl)propan-1-ol (PubChem CID 69303183) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (1S,2R)-2-(2-phenylethylamino)-1-(4-phenylmethoxyphenyl)propan-1-ol.
| Compound Name | (1S,2R)-2-(2-phenylethylamino)-1-(4-phenylmethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 69303183 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1S,2R)-2-(2-phenylethylamino)-1-(4-phenylmethoxyphenyl)propan-1-ol |
| SMILES | C[C@@H](NCCc1ccccc1)[C@@H](O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-19(25-17-16-20-8-4-2-5-9-20)24(26)22-12-14-23(15-13-22)27-18-21-10-6-3-7-11-21/h2-15,19,24-26H,16-18H2,1H3/t19-,24-/m1/s1 |
| InChIKey | RAFPDKSIOLQFRW-NTKDMRAZSA-N |
| XLogP | 4.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |