C22H26O5 — CID 67374003
ethyl 2-hydroxy-4-oxo-3-(4-phenylmethoxyphenyl)heptanoate (PubChem CID 67374003) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-oxo-3-(4-phenylmethoxyphenyl)heptanoate.
| Compound Name | ethyl 2-hydroxy-4-oxo-3-(4-phenylmethoxyphenyl)heptanoate |
|---|---|
| PubChem CID | 67374003 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl 2-hydroxy-4-oxo-3-(4-phenylmethoxyphenyl)heptanoate |
| SMILES | CCCC(=O)C(c1ccc(OCc2ccccc2)cc1)C(O)C(=O)OCC |
| InChI | InChI=1S/C22H26O5/c1-3-8-19(23)20(21(24)22(25)26-4-2)17-11-13-18(14-12-17)27-15-16-9-6-5-7-10-16/h5-7,9-14,20-21,24H,3-4,8,15H2,1-2H3 |
| InChIKey | CTGBTJRGHCLEAN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |