C20H24O6 — CID 171867271
ethyl 3-(3-ethoxy-4-phenylmethoxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 171867271) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 3-(3-ethoxy-4-phenylmethoxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-ethoxy-4-phenylmethoxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171867271 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | ethyl 3-(3-ethoxy-4-phenylmethoxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(OCc2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C20H24O6/c1-3-24-17-12-15(18(21)19(22)20(23)25-4-2)10-11-16(17)26-13-14-8-6-5-7-9-14/h5-12,18-19,21-22H,3-4,13H2,1-2H3 |
| InChIKey | OENRGGXEOLWDBD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |