C27H29NO9 — CID 70351528
ethyl (2S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoate;oxalic acid (PubChem CID 70351528) has the molecular formula C27H29NO9 and a molecular weight of 511.53 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoate;oxalic acid.
| Compound Name | ethyl (2S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoate;oxalic acid |
|---|---|
| PubChem CID | 70351528 |
| Molecular Formula | C27H29NO9 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | ethyl (2S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoate;oxalic acid |
| SMILES | CCOC(=O)[C@@H](N)C(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H27NO5.C2H2O4/c1-2-29-25(28)23(26)24(27)20-13-14-21(30-16-18-9-5-3-6-10-18)22(15-20)31-17-19-11-7-4-8-12-19;3-1(4)2(5)6/h3-15,23-24,27H,2,16-17,26H2,1H3;(H,3,4)(H,5,6)/t23-,24?;/m0./s1 |
| InChIKey | UJGJIGCGMFOYSN-APOTVMFESA-N |
| XLogP | 2.92 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|