C26H29NO4 — CID 11750488
benzyl N-[(2R)-1-hydroxy-3-methyl-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate (PubChem CID 11750488) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is benzyl N-[(2R)-1-hydroxy-3-methyl-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-hydroxy-3-methyl-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11750488 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | benzyl N-[(2R)-1-hydroxy-3-methyl-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OCc1ccccc1)C(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO4/c1-19(2)24(27-26(29)31-18-21-11-7-4-8-12-21)25(28)22-13-15-23(16-14-22)30-17-20-9-5-3-6-10-20/h3-16,19,24-25,28H,17-18H2,1-2H3,(H,27,29)/t24-,25?/m1/s1 |
| InChIKey | ZMKUACZXPYRTKY-IKOFQBKESA-N |
| XLogP | 5.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |