C13H24ClNO2Si — CID 171263199
(1R,2S)-1-amino-1-(4-trimethylsilyloxyphenyl)butan-2-ol;hydrochloride (PubChem CID 171263199) has the molecular formula C13H24ClNO2Si and a molecular weight of 289.88 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-trimethylsilyloxyphenyl)butan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(4-trimethylsilyloxyphenyl)butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263199 |
| Molecular Formula | C13H24ClNO2Si |
| Molecular Weight | 289.88 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-trimethylsilyloxyphenyl)butan-2-ol;hydrochloride |
| SMILES | CC[C@H](O)[C@H](N)c1ccc(O[Si](C)(C)C)cc1.Cl |
| InChI | InChI=1S/C13H23NO2Si.ClH/c1-5-12(15)13(14)10-6-8-11(9-7-10)16-17(2,3)4;/h6-9,12-13,15H,5,14H2,1-4H3;1H/t12-,13+;/m0./s1 |
| InChIKey | YTKWBBDAMWBDGY-JHEYCYPBSA-N |
| XLogP | 3.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.88 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|