C17H30ClNO2Si — CID 171263207
(1S,2R)-2-amino-1-cyclohexyl-2-(4-trimethylsilyloxyphenyl)ethanol;hydrochloride (PubChem CID 171263207) has the molecular formula C17H30ClNO2Si and a molecular weight of 343.97 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclohexyl-2-(4-trimethylsilyloxyphenyl)ethanol;hydrochloride.
| Compound Name | (1S,2R)-2-amino-1-cyclohexyl-2-(4-trimethylsilyloxyphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171263207 |
| Molecular Formula | C17H30ClNO2Si |
| Molecular Weight | 343.97 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclohexyl-2-(4-trimethylsilyloxyphenyl)ethanol;hydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](N)[C@@H](O)C2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C17H29NO2Si.ClH/c1-21(2,3)20-15-11-9-13(10-12-15)16(18)17(19)14-7-5-4-6-8-14;/h9-12,14,16-17,19H,4-8,18H2,1-3H3;1H/t16-,17+;/m1./s1 |
| InChIKey | VIIFUUJVXIVCDF-PPPUBMIESA-N |
| XLogP | 4.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|