C19H24ClNO2 — CID 171269374
(1R,2S)-2-amino-1-cyclopentyl-2-(4-phenoxyphenyl)ethanol;hydrochloride (PubChem CID 171269374) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclopentyl-2-(4-phenoxyphenyl)ethanol;hydrochloride.
| Compound Name | (1R,2S)-2-amino-1-cyclopentyl-2-(4-phenoxyphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171269374 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclopentyl-2-(4-phenoxyphenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(Oc2ccccc2)cc1)[C@H](O)C1CCCC1 |
| InChI | InChI=1S/C19H23NO2.ClH/c20-18(19(21)15-6-4-5-7-15)14-10-12-17(13-11-14)22-16-8-2-1-3-9-16;/h1-3,8-13,15,18-19,21H,4-7,20H2;1H/t18-,19+;/m0./s1 |
| InChIKey | KDTAOVBCJKIWFZ-GRTNUQQKSA-N |
| XLogP | 4.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |