C19H23NO — CID 45253768
2-cyclopentyl-1-(4-phenoxyphenyl)ethanamine (PubChem CID 45253768) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-cyclopentyl-1-(4-phenoxyphenyl)ethanamine.
| Compound Name | 2-cyclopentyl-1-(4-phenoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 45253768 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-cyclopentyl-1-(4-phenoxyphenyl)ethanamine |
| SMILES | NC(CC1CCCC1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO/c20-19(14-15-6-4-5-7-15)16-10-12-18(13-11-16)21-17-8-2-1-3-9-17/h1-3,8-13,15,19H,4-7,14,20H2 |
| InChIKey | QKFUCIVFQJXZAA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |