C38H54O4Si4 — CID 139887552
trimethyl-[4-[1,2,2-tris(4-trimethylsilyloxyphenyl)ethyl]phenoxy]silane (PubChem CID 139887552) has the molecular formula C38H54O4Si4 and a molecular weight of 687.19 g/mol. Its IUPAC name is trimethyl-[4-[1,2,2-tris(4-trimethylsilyloxyphenyl)ethyl]phenoxy]silane.
| Compound Name | trimethyl-[4-[1,2,2-tris(4-trimethylsilyloxyphenyl)ethyl]phenoxy]silane |
|---|---|
| PubChem CID | 139887552 |
| Molecular Formula | C38H54O4Si4 |
| Molecular Weight | 687.19 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | trimethyl-[4-[1,2,2-tris(4-trimethylsilyloxyphenyl)ethyl]phenoxy]silane |
| SMILES | C[Si](C)(C)Oc1ccc(C(c2ccc(O[Si](C)(C)C)cc2)C(c2ccc(O[Si](C)(C)C)cc2)c2ccc(O[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H54O4Si4/c1-43(2,3)39-33-21-13-29(14-22-33)37(30-15-23-34(24-16-30)40-44(4,5)6)38(31-17-25-35(26-18-31)41-45(7,8)9)32-19-27-36(28-20-32)42-46(10,11)12/h13-28,37-38H,1-12H3 |
| InChIKey | IUFYVDZFPXOEMW-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.19 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|