C11H17ClF3NOSi — CID 171242111
(1R)-2,2,2-trifluoro-1-(4-trimethylsilyloxyphenyl)ethanamine;hydrochloride (PubChem CID 171242111) has the molecular formula C11H17ClF3NOSi and a molecular weight of 299.80 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4-trimethylsilyloxyphenyl)ethanamine;hydrochloride.
| Compound Name | (1R)-2,2,2-trifluoro-1-(4-trimethylsilyloxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171242111 |
| Molecular Formula | C11H17ClF3NOSi |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(4-trimethylsilyloxyphenyl)ethanamine;hydrochloride |
| SMILES | C[Si](C)(C)Oc1ccc([C@@H](N)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C11H16F3NOSi.ClH/c1-17(2,3)16-9-6-4-8(5-7-9)10(15)11(12,13)14;/h4-7,10H,15H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | BTWCEBFCDFKEGO-HNCPQSOCSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|