C9H10F3N — CID 56971822
(1S)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine (PubChem CID 56971822) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 56971822 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(4-methylphenyl)ethanamine |
| SMILES | Cc1ccc([C@H](N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H10F3N/c1-6-2-4-7(5-3-6)8(13)9(10,11)12/h2-5,8H,13H2,1H3/t8-/m0/s1 |
| InChIKey | UXPQTBRCSUZWOK-QMMMGPOBSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |