C9H8ClF3 — CID 94794260
1-[(1S)-1-chloro-2,2,2-trifluoroethyl]-4-methylbenzene (PubChem CID 94794260) has the molecular formula C9H8ClF3 and a molecular weight of 208.61 g/mol. Its IUPAC name is 1-[(1S)-1-chloro-2,2,2-trifluoroethyl]-4-methylbenzene.
| Compound Name | 1-[(1S)-1-chloro-2,2,2-trifluoroethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 94794260 |
| Molecular Formula | C9H8ClF3 |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-[(1S)-1-chloro-2,2,2-trifluoroethyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@H](Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8ClF3/c1-6-2-4-7(5-3-6)8(10)9(11,12)13/h2-5,8H,1H3/t8-/m0/s1 |
| InChIKey | SOBQAWIVIICAHC-QMMMGPOBSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|