C10H11F3 — CID 86327346
1-methyl-4-[(2R)-1,1,1-trifluoropropan-2-yl]benzene (PubChem CID 86327346) has the molecular formula C10H11F3 and a molecular weight of 188.19 g/mol. Its IUPAC name is 1-methyl-4-[(2R)-1,1,1-trifluoropropan-2-yl]benzene.
| Compound Name | 1-methyl-4-[(2R)-1,1,1-trifluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 86327346 |
| Molecular Formula | C10H11F3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-methyl-4-[(2R)-1,1,1-trifluoropropan-2-yl]benzene |
| SMILES | Cc1ccc([C@@H](C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3/c1-7-3-5-9(6-4-7)8(2)10(11,12)13/h3-6,8H,1-2H3/t8-/m1/s1 |
| InChIKey | CSHZLCPMFZLFQT-MRVPVSSYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |