C15H21F — CID 170369205
1-(3-ethyl-3-fluoro-4-methylpent-4-en-2-yl)-4-methylbenzene (PubChem CID 170369205) has the molecular formula C15H21F and a molecular weight of 220.33 g/mol. Its IUPAC name is 1-(3-ethyl-3-fluoro-4-methylpent-4-en-2-yl)-4-methylbenzene.
| Compound Name | 1-(3-ethyl-3-fluoro-4-methylpent-4-en-2-yl)-4-methylbenzene |
|---|---|
| PubChem CID | 170369205 |
| Molecular Formula | C15H21F |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(3-ethyl-3-fluoro-4-methylpent-4-en-2-yl)-4-methylbenzene |
| SMILES | C=C(C)C(F)(CC)C(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21F/c1-6-15(16,11(2)3)13(5)14-9-7-12(4)8-10-14/h7-10,13H,2,6H2,1,3-5H3 |
| InChIKey | LJTRXFZTWZAZDG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|