C11H14F3NO — CID 82710680
1-(4-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 82710680) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(4-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 82710680 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-(4-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1ccc(C(C)NOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c1-8-3-5-10(6-4-8)9(2)15-16-7-11(12,13)14/h3-6,9,15H,7H2,1-2H3 |
| InChIKey | PPBREDIKTPRFTK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|