C12H16F3NO2 — CID 82712609
1-(2-methoxy-5-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 82712609) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 82712609 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-N-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | COc1ccc(C)cc1C(C)NOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO2/c1-8-4-5-11(17-3)10(6-8)9(2)16-18-7-12(13,14)15/h4-6,9,16H,7H2,1-3H3 |
| InChIKey | KDPZLRLHKJSMKP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|