C18H23NO2 — CID 43178128
1-(2-methoxy-5-methylphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 43178128) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43178128 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-N-[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CNC(C)c2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-13-5-10-18(21-4)17(11-13)14(2)19-12-15-6-8-16(20-3)9-7-15/h5-11,14,19H,12H2,1-4H3 |
| InChIKey | AMCOXWYJQOMIRK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |