C18H22INO2 — CID 170982893
1-(2,5-dimethoxyphenyl)-N-[(3-iodo-5-methylphenyl)methyl]ethanamine (PubChem CID 170982893) has the molecular formula C18H22INO2 and a molecular weight of 411.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-[(3-iodo-5-methylphenyl)methyl]ethanamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-[(3-iodo-5-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 170982893 |
| Molecular Formula | C18H22INO2 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-[(3-iodo-5-methylphenyl)methyl]ethanamine |
| SMILES | COc1ccc(OC)c(C(C)NCc2cc(C)cc(I)c2)c1 |
| InChI | InChI=1S/C18H22INO2/c1-12-7-14(9-15(19)8-12)11-20-13(2)17-10-16(21-3)5-6-18(17)22-4/h5-10,13,20H,11H2,1-4H3 |
| InChIKey | FSSDPRLFTOKJLN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|