C13H18F3NO3 — CID 103778618
3-[1-(2,5-dimethoxyphenyl)ethylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 103778618) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-[1-(2,5-dimethoxyphenyl)ethylamino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[1-(2,5-dimethoxyphenyl)ethylamino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 103778618 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[1-(2,5-dimethoxyphenyl)ethylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1ccc(OC)c(C(C)NCC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO3/c1-8(17-7-12(18)13(14,15)16)10-6-9(19-2)4-5-11(10)20-3/h4-6,8,12,17-18H,7H2,1-3H3 |
| InChIKey | LXMXOIUDPUFXDV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |