C18H21F2NO3 — CID 110897338
1-(2,4-difluorophenyl)-2-[1-(2,5-dimethoxyphenyl)ethylamino]ethanol (PubChem CID 110897338) has the molecular formula C18H21F2NO3 and a molecular weight of 337.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[1-(2,5-dimethoxyphenyl)ethylamino]ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-[1-(2,5-dimethoxyphenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 110897338 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[1-(2,5-dimethoxyphenyl)ethylamino]ethanol |
| SMILES | COc1ccc(OC)c(C(C)NCC(O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H21F2NO3/c1-11(15-9-13(23-2)5-7-18(15)24-3)21-10-17(22)14-6-4-12(19)8-16(14)20/h4-9,11,17,21-22H,10H2,1-3H3 |
| InChIKey | LPODKPPMEAUBSI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |