C18H23NO4 — CID 97349384
3-[(1S)-1-[[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]ethyl]-4-methoxyphenol (PubChem CID 97349384) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-[(1S)-1-[[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]ethyl]-4-methoxyphenol.
| Compound Name | 3-[(1S)-1-[[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]ethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 97349384 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[(1S)-1-[[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]amino]ethyl]-4-methoxyphenol |
| SMILES | COc1ccc([C@@H](O)CN[C@@H](C)c2cc(O)ccc2OC)cc1 |
| InChI | InChI=1S/C18H23NO4/c1-12(16-10-14(20)6-9-18(16)23-3)19-11-17(21)13-4-7-15(22-2)8-5-13/h4-10,12,17,19-21H,11H2,1-3H3/t12-,17-/m0/s1 |
| InChIKey | QBYQBODZMRPFGN-SJCJKPOMSA-N |
| XLogP | 2.79 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |