C21H30N2O3 — CID 71136549
1,3-bis[[(1S)-1-(4-methoxyphenyl)ethyl]amino]propan-2-ol (PubChem CID 71136549) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1,3-bis[[(1S)-1-(4-methoxyphenyl)ethyl]amino]propan-2-ol.
| Compound Name | 1,3-bis[[(1S)-1-(4-methoxyphenyl)ethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 71136549 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1,3-bis[[(1S)-1-(4-methoxyphenyl)ethyl]amino]propan-2-ol |
| SMILES | COc1ccc([C@H](C)NCC(O)CN[C@@H](C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H30N2O3/c1-15(17-5-9-20(25-3)10-6-17)22-13-19(24)14-23-16(2)18-7-11-21(26-4)12-8-18/h5-12,15-16,19,22-24H,13-14H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | ZFLVJPNQWJOBLZ-HOTGVXAUSA-N |
| XLogP | 3.07 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |