C19H26N2O — CID 15470316
1,3-bis[[(1S)-1-phenylethyl]amino]propan-2-ol (PubChem CID 15470316) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1,3-bis[[(1S)-1-phenylethyl]amino]propan-2-ol.
| Compound Name | 1,3-bis[[(1S)-1-phenylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 15470316 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1,3-bis[[(1S)-1-phenylethyl]amino]propan-2-ol |
| SMILES | C[C@H](NCC(O)CN[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O/c1-15(17-9-5-3-6-10-17)20-13-19(22)14-21-16(2)18-11-7-4-8-12-18/h3-12,15-16,19-22H,13-14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | WCDHEYGAWJJMQW-HOTGVXAUSA-N |
| XLogP | 3.05 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |