C15H25NO — CID 103717042
4,4-dimethyl-1-(1-phenylethylamino)pentan-2-ol (PubChem CID 103717042) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4,4-dimethyl-1-(1-phenylethylamino)pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-(1-phenylethylamino)pentan-2-ol |
|---|---|
| PubChem CID | 103717042 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4,4-dimethyl-1-(1-phenylethylamino)pentan-2-ol |
| SMILES | CC(NCC(O)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H25NO/c1-12(13-8-6-5-7-9-13)16-11-14(17)10-15(2,3)4/h5-9,12,14,16-17H,10-11H2,1-4H3 |
| InChIKey | WBPWIJDZDIETNU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |