C13H14F3NOS — CID 82712085
1-(3-methyl-1-benzothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 82712085) has the molecular formula C13H14F3NOS and a molecular weight of 289.32 g/mol. Its IUPAC name is 1-(3-methyl-1-benzothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(3-methyl-1-benzothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 82712085 |
| Molecular Formula | C13H14F3NOS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(3-methyl-1-benzothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1c(C(C)NOCC(F)(F)F)sc2ccccc12 |
| InChI | InChI=1S/C13H14F3NOS/c1-8-10-5-3-4-6-11(10)19-12(8)9(2)17-18-7-13(14,15)16/h3-6,9,17H,7H2,1-2H3 |
| InChIKey | KSQDXEMWXCYNBL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|