C14H19NOS — CID 43770603
3-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]propan-1-ol (PubChem CID 43770603) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]propan-1-ol.
| Compound Name | 3-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 43770603 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]propan-1-ol |
| SMILES | Cc1c(C(C)NCCCO)sc2ccccc12 |
| InChI | InChI=1S/C14H19NOS/c1-10-12-6-3-4-7-13(12)17-14(10)11(2)15-8-5-9-16/h3-4,6-7,11,15-16H,5,8-9H2,1-2H3 |
| InChIKey | HTNVNRZDIBTBPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|