C15H22N2O2S2 — CID 106334491
N-ethyl-2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]ethanesulfonamide (PubChem CID 106334491) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-ethyl-2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106334491 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-ethyl-2-[1-(3-methyl-1-benzothiophen-2-yl)ethylamino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC(C)c1sc2ccccc2c1C |
| InChI | InChI=1S/C15H22N2O2S2/c1-4-17-21(18,19)10-9-16-12(3)15-11(2)13-7-5-6-8-14(13)20-15/h5-8,12,16-17H,4,9-10H2,1-3H3 |
| InChIKey | KDCQESJQTHMHPE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |