C19H21NS — CID 43764320
4-ethyl-N-[1-(3-methyl-1-benzothiophen-2-yl)ethyl]aniline (PubChem CID 43764320) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-ethyl-N-[1-(3-methyl-1-benzothiophen-2-yl)ethyl]aniline.
| Compound Name | 4-ethyl-N-[1-(3-methyl-1-benzothiophen-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43764320 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-ethyl-N-[1-(3-methyl-1-benzothiophen-2-yl)ethyl]aniline |
| SMILES | CCc1ccc(NC(C)c2sc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C19H21NS/c1-4-15-9-11-16(12-10-15)20-14(3)19-13(2)17-7-5-6-8-18(17)21-19/h5-12,14,20H,4H2,1-3H3 |
| InChIKey | DEQBKADRLNISJW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |