C11H12F3NO2S — CID 81341154
2-(4-methylphenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81341154) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-(4-methylphenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 81341154 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1ccc(SCC(=O)NOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO2S/c1-8-2-4-9(5-3-8)18-6-10(16)15-17-7-11(12,13)14/h2-5H,6-7H2,1H3,(H,15,16) |
| InChIKey | JQVQXYPHQQFAQN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|