C12H13ClF3NO2S — CID 81341007
4-(4-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)butanamide (PubChem CID 81341007) has the molecular formula C12H13ClF3NO2S and a molecular weight of 327.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)butanamide |
|---|---|
| PubChem CID | 81341007 |
| Molecular Formula | C12H13ClF3NO2S |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethoxy)butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)NOCC(F)(F)F |
| InChI | InChI=1S/C12H13ClF3NO2S/c13-9-3-5-10(6-4-9)20-7-1-2-11(18)17-19-8-12(14,15)16/h3-6H,1-2,7-8H2,(H,17,18) |
| InChIKey | HPXKFTOKTZQDMJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|