C16H14ClF2NOS — CID 134059340
4-(4-chlorophenyl)sulfanyl-N-(2,5-difluorophenyl)butanamide (PubChem CID 134059340) has the molecular formula C16H14ClF2NOS and a molecular weight of 341.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(2,5-difluorophenyl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(2,5-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 134059340 |
| Molecular Formula | C16H14ClF2NOS |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(2,5-difluorophenyl)butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H14ClF2NOS/c17-11-3-6-13(7-4-11)22-9-1-2-16(21)20-15-10-12(18)5-8-14(15)19/h3-8,10H,1-2,9H2,(H,20,21) |
| InChIKey | NLANABRAQNLSFD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|