C16H14Cl2FN3O2S — CID 60609405
1-(2,5-dichlorophenyl)-3-[3-(4-fluorophenyl)sulfanylpropanoylamino]urea (PubChem CID 60609405) has the molecular formula C16H14Cl2FN3O2S and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[3-(4-fluorophenyl)sulfanylpropanoylamino]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[3-(4-fluorophenyl)sulfanylpropanoylamino]urea |
|---|---|
| PubChem CID | 60609405 |
| Molecular Formula | C16H14Cl2FN3O2S |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[3-(4-fluorophenyl)sulfanylpropanoylamino]urea |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2FN3O2S/c17-10-1-6-13(18)14(9-10)20-16(24)22-21-15(23)7-8-25-12-4-2-11(19)3-5-12/h1-6,9H,7-8H2,(H,21,23)(H2,20,22,24) |
| InChIKey | MOFFDLSBHGQZBY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|