C17H18FNOS — CID 7546514
N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 7546514) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7546514 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(NC(=O)CCSc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FNOS/c1-12-9-13(2)11-15(10-12)19-17(20)7-8-21-16-5-3-14(18)4-6-16/h3-6,9-11H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | PNMGVWIYNQKUAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |