C17H19FN2O — CID 109035607
N-(3,5-dimethylphenyl)-3-(4-fluoroanilino)propanamide (PubChem CID 109035607) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3-(4-fluoroanilino)propanamide.
| Compound Name | N-(3,5-dimethylphenyl)-3-(4-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 109035607 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3-(4-fluoroanilino)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)CCNc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-12-9-13(2)11-16(10-12)20-17(21)7-8-19-15-5-3-14(18)4-6-15/h3-6,9-11,19H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | MPUUXRLOAXMXFH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |