C18H21NO3S — CID 23973490
N-(3,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfanylpropanamide (PubChem CID 23973490) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 23973490 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfanylpropanamide |
| SMILES | COc1cc(NC(=O)CCSc2ccc(C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C18H21NO3S/c1-13-4-6-17(7-5-13)23-9-8-18(20)19-14-10-15(21-2)12-16(11-14)22-3/h4-7,10-12H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | HQODJXJXGLQPLR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |