C24H26N2O2S2 — CID 142489795
N-[4-(2-methoxy-5-methylanilino)sulfanylphenyl]-3-(4-methylphenyl)sulfanylpropanamide (PubChem CID 142489795) has the molecular formula C24H26N2O2S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[4-(2-methoxy-5-methylanilino)sulfanylphenyl]-3-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | N-[4-(2-methoxy-5-methylanilino)sulfanylphenyl]-3-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 142489795 |
| Molecular Formula | C24H26N2O2S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[4-(2-methoxy-5-methylanilino)sulfanylphenyl]-3-(4-methylphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(C)cc1NSc1ccc(NC(=O)CCSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O2S2/c1-17-4-9-20(10-5-17)29-15-14-24(27)25-19-7-11-21(12-8-19)30-26-22-16-18(2)6-13-23(22)28-3/h4-13,16,26H,14-15H2,1-3H3,(H,25,27) |
| InChIKey | UOQLXPMQJJGAIH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|