C23H23IN2O5S2 — CID 142489777
N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-(4-iodophenyl)sulfanylpropanamide (PubChem CID 142489777) has the molecular formula C23H23IN2O5S2 and a molecular weight of 598.48 g/mol. Its IUPAC name is N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-(4-iodophenyl)sulfanylpropanamide.
| Compound Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-(4-iodophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 142489777 |
| Molecular Formula | C23H23IN2O5S2 |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-3-(4-iodophenyl)sulfanylpropanamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(NC(=O)CCSc3ccc(I)cc3)cc2)c1 |
| InChI | InChI=1S/C23H23IN2O5S2/c1-30-18-7-12-22(31-2)21(15-18)26-33(28,29)20-10-5-17(6-11-20)25-23(27)13-14-32-19-8-3-16(24)4-9-19/h3-12,15,26H,13-14H2,1-2H3,(H,25,27) |
| InChIKey | FCXWJNFOYDUJFE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|