C17H15IN2O5S2 — CID 142489776
[3-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-3-oxoprop-1-ynyl] thiohypoiodite (PubChem CID 142489776) has the molecular formula C17H15IN2O5S2 and a molecular weight of 518.35 g/mol. Its IUPAC name is [3-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-3-oxoprop-1-ynyl] thiohypoiodite.
| Compound Name | [3-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-3-oxoprop-1-ynyl] thiohypoiodite |
|---|---|
| PubChem CID | 142489776 |
| Molecular Formula | C17H15IN2O5S2 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | [3-[4-[(2,5-dimethoxyphenyl)sulfamoyl]anilino]-3-oxoprop-1-ynyl] thiohypoiodite |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(NC(=O)C#CSI)cc2)c1 |
| InChI | InChI=1S/C17H15IN2O5S2/c1-24-13-5-8-16(25-2)15(11-13)20-27(22,23)14-6-3-12(4-7-14)19-17(21)9-10-26-18/h3-8,11,20H,1-2H3,(H,19,21) |
| InChIKey | JMFUCZWATPNQHK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|