C17H17N3O5S — CID 168521474
2-cyano-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 168521474) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-cyano-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 168521474 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-cyano-N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)CC#N)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H17N3O5S/c1-24-13-5-8-15(16(11-13)25-2)20-26(22,23)14-6-3-12(4-7-14)19-17(21)9-10-18/h3-8,11,20H,9H2,1-2H3,(H,19,21) |
| InChIKey | HAUFSLZGRVZUBJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |