C19H24N2O5S — CID 21335908
N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide (PubChem CID 21335908) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 21335908 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-5-13(2)19(22)20-14-6-9-16(10-7-14)27(23,24)21-17-11-8-15(25-3)12-18(17)26-4/h6-13,21H,5H2,1-4H3,(H,20,22) |
| InChIKey | XYDJRXZUIMRKFK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |