C15H11Cl2N3O3S — CID 17069573
2-cyano-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 17069573) has the molecular formula C15H11Cl2N3O3S and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-cyano-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 17069573 |
| Molecular Formula | C15H11Cl2N3O3S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-cyano-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H11Cl2N3O3S/c16-10-7-11(17)9-13(8-10)20-24(22,23)14-3-1-12(2-4-14)19-15(21)5-6-18/h1-4,7-9,20H,5H2,(H,19,21) |
| InChIKey | DUOREMSKTWAATH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |