C17H15ClN4O3S — CID 127048849
N-[(E)-1-[4-[(4-chlorophenyl)sulfonylamino]phenyl]ethylideneamino]-2-cyanoacetamide (PubChem CID 127048849) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is N-[(E)-1-[4-[(4-chlorophenyl)sulfonylamino]phenyl]ethylideneamino]-2-cyanoacetamide.
| Compound Name | N-[(E)-1-[4-[(4-chlorophenyl)sulfonylamino]phenyl]ethylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 127048849 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[(E)-1-[4-[(4-chlorophenyl)sulfonylamino]phenyl]ethylideneamino]-2-cyanoacetamide |
| SMILES | C/C(=N\NC(=O)CC#N)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H15ClN4O3S/c1-12(20-21-17(23)10-11-19)13-2-6-15(7-3-13)22-26(24,25)16-8-4-14(18)5-9-16/h2-9,22H,10H2,1H3,(H,21,23)/b20-12+ |
| InChIKey | SVDGWGSHWLIFAD-UDWIEESQSA-N |
| XLogP | 2.89 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|